C12H10BrN3O3S — CID 43623885
ethyl 3-bromo-4-(1,2,5-thiadiazole-3-carbonylamino)benzoate (PubChem CID 43623885) has the molecular formula C12H10BrN3O3S and a molecular weight of 356.20 g/mol. Its IUPAC name is ethyl 3-bromo-4-(1,2,5-thiadiazole-3-carbonylamino)benzoate.
| Compound Name | ethyl 3-bromo-4-(1,2,5-thiadiazole-3-carbonylamino)benzoate |
|---|---|
| PubChem CID | 43623885 |
| Molecular Formula | C12H10BrN3O3S |
| Molecular Weight | 356.20 g/mol |
| Exact Mass | 354.96 |
| IUPAC Name | ethyl 3-bromo-4-(1,2,5-thiadiazole-3-carbonylamino)benzoate |
| SMILES | CCOC(=O)c1ccc(NC(=O)c2cnsn2)c(Br)c1 |
| InChI | InChI=1S/C12H10BrN3O3S/c1-2-19-12(18)7-3-4-9(8(13)5-7)15-11(17)10-6-14-20-16-10/h3-6H,2H2,1H3,(H,15,17) |
| InChIKey | KMECETNPVFMPRV-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 81.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.20 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |