C14H13BrN2O4 — CID 43423490
ethyl 3-bromo-4-[(3-methyl-1,2-oxazole-5-carbonyl)amino]benzoate (PubChem CID 43423490) has the molecular formula C14H13BrN2O4 and a molecular weight of 353.17 g/mol. Its IUPAC name is ethyl 3-bromo-4-[(3-methyl-1,2-oxazole-5-carbonyl)amino]benzoate.
| Compound Name | ethyl 3-bromo-4-[(3-methyl-1,2-oxazole-5-carbonyl)amino]benzoate |
|---|---|
| PubChem CID | 43423490 |
| Molecular Formula | C14H13BrN2O4 |
| Molecular Weight | 353.17 g/mol |
| Exact Mass | 352.01 |
| IUPAC Name | ethyl 3-bromo-4-[(3-methyl-1,2-oxazole-5-carbonyl)amino]benzoate |
| SMILES | CCOC(=O)c1ccc(NC(=O)c2cc(C)no2)c(Br)c1 |
| InChI | InChI=1S/C14H13BrN2O4/c1-3-20-14(19)9-4-5-11(10(15)7-9)16-13(18)12-6-8(2)17-21-12/h4-7H,3H2,1-2H3,(H,16,18) |
| InChIKey | XKERSXGCDCRBPF-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 81.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.17 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |