C12H12BrN3OS — CID 113456224
N-(5-amino-2-bromo-4-methylphenyl)-4-methyl-1,3-thiazole-5-carboxamide (PubChem CID 113456224) has the molecular formula C12H12BrN3OS and a molecular weight of 326.22 g/mol. Its IUPAC name is N-(5-amino-2-bromo-4-methylphenyl)-4-methyl-1,3-thiazole-5-carboxamide.
| Compound Name | N-(5-amino-2-bromo-4-methylphenyl)-4-methyl-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 113456224 |
| Molecular Formula | C12H12BrN3OS |
| Molecular Weight | 326.22 g/mol |
| Exact Mass | 324.99 |
| IUPAC Name | N-(5-amino-2-bromo-4-methylphenyl)-4-methyl-1,3-thiazole-5-carboxamide |
| SMILES | Cc1cc(Br)c(NC(=O)c2scnc2C)cc1N |
| InChI | InChI=1S/C12H12BrN3OS/c1-6-3-8(13)10(4-9(6)14)16-12(17)11-7(2)15-5-18-11/h3-5H,14H2,1-2H3,(H,16,17) |
| InChIKey | RTEPLHAEDPOTJB-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.22 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|