C10H7BrClN3OS — CID 103816486
N-(5-bromo-6-chloro-3-pyridinyl)-4-methyl-1,3-thiazole-5-carboxamide (PubChem CID 103816486) has the molecular formula C10H7BrClN3OS and a molecular weight of 332.61 g/mol. Its IUPAC name is N-(5-bromo-6-chloro-3-pyridinyl)-4-methyl-1,3-thiazole-5-carboxamide.
| Compound Name | N-(5-bromo-6-chloro-3-pyridinyl)-4-methyl-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 103816486 |
| Molecular Formula | C10H7BrClN3OS |
| Molecular Weight | 332.61 g/mol |
| Exact Mass | 330.92 |
| IUPAC Name | N-(5-bromo-6-chloro-3-pyridinyl)-4-methyl-1,3-thiazole-5-carboxamide |
| SMILES | Cc1ncsc1C(=O)Nc1cnc(Cl)c(Br)c1 |
| InChI | InChI=1S/C10H7BrClN3OS/c1-5-8(17-4-14-5)10(16)15-6-2-7(11)9(12)13-3-6/h2-4H,1H3,(H,15,16) |
| InChIKey | GUPJTAKVQWDYMW-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.61 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|