C12H9Br3N2OS — CID 107959542
N-(5-amino-2-bromo-4-methylphenyl)-2,5-dibromothiophene-3-carboxamide (PubChem CID 107959542) has the molecular formula C12H9Br3N2OS and a molecular weight of 469.00 g/mol. Its IUPAC name is N-(5-amino-2-bromo-4-methylphenyl)-2,5-dibromothiophene-3-carboxamide.
| Compound Name | N-(5-amino-2-bromo-4-methylphenyl)-2,5-dibromothiophene-3-carboxamide |
|---|---|
| PubChem CID | 107959542 |
| Molecular Formula | C12H9Br3N2OS |
| Molecular Weight | 469.00 g/mol |
| Exact Mass | 465.80 |
| IUPAC Name | N-(5-amino-2-bromo-4-methylphenyl)-2,5-dibromothiophene-3-carboxamide |
| SMILES | Cc1cc(Br)c(NC(=O)c2cc(Br)sc2Br)cc1N |
| InChI | InChI=1S/C12H9Br3N2OS/c1-5-2-7(13)9(4-8(5)16)17-12(18)6-3-10(14)19-11(6)15/h2-4H,16H2,1H3,(H,17,18) |
| InChIKey | PCSLEJQKYUDWSV-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.00 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|