C13H9Br2NO2S — CID 113237224
N-(2-acetylphenyl)-2,5-dibromothiophene-3-carboxamide (PubChem CID 113237224) has the molecular formula C13H9Br2NO2S and a molecular weight of 403.10 g/mol. Its IUPAC name is N-(2-acetylphenyl)-2,5-dibromothiophene-3-carboxamide.
| Compound Name | N-(2-acetylphenyl)-2,5-dibromothiophene-3-carboxamide |
|---|---|
| PubChem CID | 113237224 |
| Molecular Formula | C13H9Br2NO2S |
| Molecular Weight | 403.10 g/mol |
| Exact Mass | 400.87 |
| IUPAC Name | N-(2-acetylphenyl)-2,5-dibromothiophene-3-carboxamide |
| SMILES | CC(=O)c1ccccc1NC(=O)c1cc(Br)sc1Br |
| InChI | InChI=1S/C13H9Br2NO2S/c1-7(17)8-4-2-3-5-10(8)16-13(18)9-6-11(14)19-12(9)15/h2-6H,1H3,(H,16,18) |
| InChIKey | NOBCFWBOEGNXKJ-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.10 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |