C15H11Cl2NO2 — CID 26067712
N-(2-acetylphenyl)-2,5-dichlorobenzamide (PubChem CID 26067712) has the molecular formula C15H11Cl2NO2 and a molecular weight of 308.16 g/mol. Its IUPAC name is N-(2-acetylphenyl)-2,5-dichlorobenzamide.
| Compound Name | N-(2-acetylphenyl)-2,5-dichlorobenzamide |
|---|---|
| PubChem CID | 26067712 |
| Molecular Formula | C15H11Cl2NO2 |
| Molecular Weight | 308.16 g/mol |
| Exact Mass | 307.02 |
| IUPAC Name | N-(2-acetylphenyl)-2,5-dichlorobenzamide |
| SMILES | CC(=O)c1ccccc1NC(=O)c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C15H11Cl2NO2/c1-9(19)11-4-2-3-5-14(11)18-15(20)12-8-10(16)6-7-13(12)17/h2-8H,1H3,(H,18,20) |
| InChIKey | SXVSHZRSHJJPIJ-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.16 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |