C19H21Cl2N3O2 — CID 71296271
2,5-dichloro-N-[2-[3-(dimethylamino)propylcarbamoyl]phenyl]benzamide (PubChem CID 71296271) has the molecular formula C19H21Cl2N3O2 and a molecular weight of 394.30 g/mol. Its IUPAC name is 2,5-dichloro-N-[2-[3-(dimethylamino)propylcarbamoyl]phenyl]benzamide.
| Compound Name | 2,5-dichloro-N-[2-[3-(dimethylamino)propylcarbamoyl]phenyl]benzamide |
|---|---|
| PubChem CID | 71296271 |
| Molecular Formula | C19H21Cl2N3O2 |
| Molecular Weight | 394.30 g/mol |
| Exact Mass | 393.10 |
| IUPAC Name | 2,5-dichloro-N-[2-[3-(dimethylamino)propylcarbamoyl]phenyl]benzamide |
| SMILES | CN(C)CCCNC(=O)c1ccccc1NC(=O)c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C19H21Cl2N3O2/c1-24(2)11-5-10-22-18(25)14-6-3-4-7-17(14)23-19(26)15-12-13(20)8-9-16(15)21/h3-4,6-9,12H,5,10-11H2,1-2H3,(H,22,25)(H,23,26) |
| InChIKey | NVGMFXDMLUPRKM-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.30 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|