C11H5Br2N3OS2 — CID 114021290
2,5-dibromo-N-(8λ4-thia-7,9-diazabicyclo[4.3.0]nona-1(6),2,4,7,8-pentaen-2-yl)thiophene-3-carboxamide (PubChem CID 114021290) has the molecular formula C11H5Br2N3OS2 and a molecular weight of 419.12 g/mol. Its IUPAC name is 2,5-dibromo-N-(8λ4-thia-7,9-diazabicyclo[4.3.0]nona-1(6),2,4,7,8-pentaen-2-yl)thiophene-3-carboxamide.
| Compound Name | 2,5-dibromo-N-(8λ4-thia-7,9-diazabicyclo[4.3.0]nona-1(6),2,4,7,8-pentaen-2-yl)thiophene-3-carboxamide |
|---|---|
| PubChem CID | 114021290 |
| Molecular Formula | C11H5Br2N3OS2 |
| Molecular Weight | 419.12 g/mol |
| Exact Mass | 416.82 |
| IUPAC Name | 2,5-dibromo-N-(8λ4-thia-7,9-diazabicyclo[4.3.0]nona-1(6),2,4,7,8-pentaen-2-yl)thiophene-3-carboxamide |
| SMILES | O=C(Nc1cccc2c1N=S=N2)c1cc(Br)sc1Br |
| InChI | InChI=1S/C11H5Br2N3OS2/c12-8-4-5(10(13)18-8)11(17)14-6-2-1-3-7-9(6)16-19-15-7/h1-4H,(H,14,17) |
| InChIKey | MKVUCXNTPVFYON-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 53.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.12 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |