2-[(2,5-dibromothiophene-3-carbonyl)amino]benzoic acid

C12H7Br2NO3S — CID 104952989

IUPAC2-[(2,5-dibromothiophene-3-carbonyl)amino]benzoic acid
SMILESO=C(O)c1ccccc1NC(=O)c1cc(Br)sc1Br
InChIInChI=1S/C12H7Br2NO3S/c13-9-5-7(10(14)19-9)11(16)15-8-4-2-1-3-6(8)12(17)18/h1-5H,(H,15,16)(H,17,18)
InChIKeyXUNDGDFZNIBHFP-UHFFFAOYSA-N
MW405.07 g/mol
LogP4.22
Rot. Bonds3

About 2-[(2,5-dibromothiophene-3-carbonyl)amino]benzoic acid

2-[(2,5-dibromothiophene-3-carbonyl)amino]benzoic acid (PubChem CID 104952989) has the molecular formula C12H7Br2NO3S and a molecular weight of 405.07 g/mol. Its IUPAC name is 2-[(2,5-dibromothiophene-3-carbonyl)amino]benzoic acid.

Molecular Properties

Compound Name2-[(2,5-dibromothiophene-3-carbonyl)amino]benzoic acid
PubChem CID104952989
Molecular FormulaC12H7Br2NO3S
Molecular Weight405.07 g/mol
Exact Mass402.85
IUPAC Name2-[(2,5-dibromothiophene-3-carbonyl)amino]benzoic acid
SMILESO=C(O)c1ccccc1NC(=O)c1cc(Br)sc1Br
InChIInChI=1S/C12H7Br2NO3S/c13-9-5-7(10(14)19-9)11(16)15-8-4-2-1-3-6(8)12(17)18/h1-5H,(H,15,16)(H,17,18)
InChIKeyXUNDGDFZNIBHFP-UHFFFAOYSA-N
XLogP4.22
TPSA66.40 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500405.07
LogP ≤ 54.22
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze 2-[(2,5-dibromothiophene-3-carbonyl)amino]benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[(2,5-dibromothiophene-3-carbonyl)amino]benzoic acid?
The IUPAC name of 2-[(2,5-dibromothiophene-3-carbonyl)amino]benzoic acid (CID 104952989) is 2-[(2,5-dibromothiophene-3-carbonyl)amino]benzoic acid.
What is the SMILES notation for 2-[(2,5-dibromothiophene-3-carbonyl)amino]benzoic acid?
The canonical SMILES for 2-[(2,5-dibromothiophene-3-carbonyl)amino]benzoic acid is O=C(O)c1ccccc1NC(=O)c1cc(Br)sc1Br.
What is the InChIKey of 2-[(2,5-dibromothiophene-3-carbonyl)amino]benzoic acid?
The InChIKey is XUNDGDFZNIBHFP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H7Br2NO3S/c13-9-5-7(10(14)19-9)11(16)15-8-4-2-1-3-6(8)12(17)18/h1-5H,(H,15,16)(H,17,18).
What are the key properties of 2-[(2,5-dibromothiophene-3-carbonyl)amino]benzoic acid?
2-[(2,5-dibromothiophene-3-carbonyl)amino]benzoic acid has a molecular weight of 405.07 g/mol, XLogP of 4.22, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2,5-dibromothiophene-3-carbonyl)amino]benzoic acid is sourced from PubChem (CID 104952989), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).