C12H7Br2NO3S — CID 104952989
2-[(2,5-dibromothiophene-3-carbonyl)amino]benzoic acid (PubChem CID 104952989) has the molecular formula C12H7Br2NO3S and a molecular weight of 405.07 g/mol. Its IUPAC name is 2-[(2,5-dibromothiophene-3-carbonyl)amino]benzoic acid.
| Compound Name | 2-[(2,5-dibromothiophene-3-carbonyl)amino]benzoic acid |
|---|---|
| PubChem CID | 104952989 |
| Molecular Formula | C12H7Br2NO3S |
| Molecular Weight | 405.07 g/mol |
| Exact Mass | 402.85 |
| IUPAC Name | 2-[(2,5-dibromothiophene-3-carbonyl)amino]benzoic acid |
| SMILES | O=C(O)c1ccccc1NC(=O)c1cc(Br)sc1Br |
| InChI | InChI=1S/C12H7Br2NO3S/c13-9-5-7(10(14)19-9)11(16)15-8-4-2-1-3-6(8)12(17)18/h1-5H,(H,15,16)(H,17,18) |
| InChIKey | XUNDGDFZNIBHFP-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.07 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |