C12H6Br2FNO3S — CID 107949385
2-[(2,5-dibromothiophene-3-carbonyl)amino]-3-fluorobenzoic acid (PubChem CID 107949385) has the molecular formula C12H6Br2FNO3S and a molecular weight of 423.06 g/mol. Its IUPAC name is 2-[(2,5-dibromothiophene-3-carbonyl)amino]-3-fluorobenzoic acid.
| Compound Name | 2-[(2,5-dibromothiophene-3-carbonyl)amino]-3-fluorobenzoic acid |
|---|---|
| PubChem CID | 107949385 |
| Molecular Formula | C12H6Br2FNO3S |
| Molecular Weight | 423.06 g/mol |
| Exact Mass | 420.84 |
| IUPAC Name | 2-[(2,5-dibromothiophene-3-carbonyl)amino]-3-fluorobenzoic acid |
| SMILES | O=C(Nc1c(F)cccc1C(=O)O)c1cc(Br)sc1Br |
| InChI | InChI=1S/C12H6Br2FNO3S/c13-8-4-6(10(14)20-8)11(17)16-9-5(12(18)19)2-1-3-7(9)15/h1-4H,(H,16,17)(H,18,19) |
| InChIKey | FCSPJWBPVXNMTL-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.06 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |