C11H5Br2Cl2NOS — CID 113237204
2,5-dibromo-N-(2,4-dichlorophenyl)thiophene-3-carboxamide (PubChem CID 113237204) has the molecular formula C11H5Br2Cl2NOS and a molecular weight of 429.95 g/mol. Its IUPAC name is 2,5-dibromo-N-(2,4-dichlorophenyl)thiophene-3-carboxamide.
| Compound Name | 2,5-dibromo-N-(2,4-dichlorophenyl)thiophene-3-carboxamide |
|---|---|
| PubChem CID | 113237204 |
| Molecular Formula | C11H5Br2Cl2NOS |
| Molecular Weight | 429.95 g/mol |
| Exact Mass | 426.78 |
| IUPAC Name | 2,5-dibromo-N-(2,4-dichlorophenyl)thiophene-3-carboxamide |
| SMILES | O=C(Nc1ccc(Cl)cc1Cl)c1cc(Br)sc1Br |
| InChI | InChI=1S/C11H5Br2Cl2NOS/c12-9-4-6(10(13)18-9)11(17)16-8-2-1-5(14)3-7(8)15/h1-4H,(H,16,17) |
| InChIKey | KSMQIXRHASOCMF-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.95 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |