C13H11Br2NO2S — CID 113237216
2,5-dibromo-N-(2-methoxy-5-methylphenyl)thiophene-3-carboxamide (PubChem CID 113237216) has the molecular formula C13H11Br2NO2S and a molecular weight of 405.11 g/mol. Its IUPAC name is 2,5-dibromo-N-(2-methoxy-5-methylphenyl)thiophene-3-carboxamide.
| Compound Name | 2,5-dibromo-N-(2-methoxy-5-methylphenyl)thiophene-3-carboxamide |
|---|---|
| PubChem CID | 113237216 |
| Molecular Formula | C13H11Br2NO2S |
| Molecular Weight | 405.11 g/mol |
| Exact Mass | 402.89 |
| IUPAC Name | 2,5-dibromo-N-(2-methoxy-5-methylphenyl)thiophene-3-carboxamide |
| SMILES | COc1ccc(C)cc1NC(=O)c1cc(Br)sc1Br |
| InChI | InChI=1S/C13H11Br2NO2S/c1-7-3-4-10(18-2)9(5-7)16-13(17)8-6-11(14)19-12(8)15/h3-6H,1-2H3,(H,16,17) |
| InChIKey | YTINKUZYZWVNLU-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.11 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |