C12H10Br2N2O2S — CID 103805348
N-(4-amino-3-methoxyphenyl)-2,5-dibromothiophene-3-carboxamide (PubChem CID 103805348) has the molecular formula C12H10Br2N2O2S and a molecular weight of 406.10 g/mol. Its IUPAC name is N-(4-amino-3-methoxyphenyl)-2,5-dibromothiophene-3-carboxamide.
| Compound Name | N-(4-amino-3-methoxyphenyl)-2,5-dibromothiophene-3-carboxamide |
|---|---|
| PubChem CID | 103805348 |
| Molecular Formula | C12H10Br2N2O2S |
| Molecular Weight | 406.10 g/mol |
| Exact Mass | 403.88 |
| IUPAC Name | N-(4-amino-3-methoxyphenyl)-2,5-dibromothiophene-3-carboxamide |
| SMILES | COc1cc(NC(=O)c2cc(Br)sc2Br)ccc1N |
| InChI | InChI=1S/C12H10Br2N2O2S/c1-18-9-4-6(2-3-8(9)15)16-12(17)7-5-10(13)19-11(7)14/h2-5H,15H2,1H3,(H,16,17) |
| InChIKey | SDZAFXSPPKCYPR-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.10 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|