About 2-(2-oxoazepan-1-yl)ethyl 4-methyl-1,3-thiazole-5-carboxylate
2-(2-oxoazepan-1-yl)ethyl 4-methyl-1,3-thiazole-5-carboxylate (PubChem CID 71988147) has the molecular formula C13H18N2O3S
and a molecular weight of 282.36 g/mol. Its IUPAC name is 2-(2-oxoazepan-1-yl)ethyl 4-methyl-1,3-thiazole-5-carboxylate.
Analyze 2-(2-oxoazepan-1-yl)ethyl 4-methyl-1,3-thiazole-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-oxoazepan-1-yl)ethyl 4-methyl-1,3-thiazole-5-carboxylate?
The IUPAC name of 2-(2-oxoazepan-1-yl)ethyl 4-methyl-1,3-thiazole-5-carboxylate (CID 71988147) is 2-(2-oxoazepan-1-yl)ethyl 4-methyl-1,3-thiazole-5-carboxylate.
What is the SMILES notation for 2-(2-oxoazepan-1-yl)ethyl 4-methyl-1,3-thiazole-5-carboxylate?
The canonical SMILES for 2-(2-oxoazepan-1-yl)ethyl 4-methyl-1,3-thiazole-5-carboxylate is Cc1ncsc1C(=O)OCCN1CCCCCC1=O.
What is the InChIKey of 2-(2-oxoazepan-1-yl)ethyl 4-methyl-1,3-thiazole-5-carboxylate?
The InChIKey is RWEYACJHEDZWQA-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18N2O3S/c1-10-12(19-9-14-10)13(17)18-8-7-15-6-4-2-3-5-11(15)16/h9H,2-8H2,1H3.
What are the key properties of 2-(2-oxoazepan-1-yl)ethyl 4-methyl-1,3-thiazole-5-carboxylate?
2-(2-oxoazepan-1-yl)ethyl 4-methyl-1,3-thiazole-5-carboxylate has a molecular weight of 282.36 g/mol, XLogP of 2.01, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-oxoazepan-1-yl)ethyl 4-methyl-1,3-thiazole-5-carboxylate is sourced from PubChem (CID 71988147), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).