C17H25N3O3 — CID 91652121
3-(2-oxopiperidin-1-yl)propyl 1,4,5,6,7,8-hexahydrocyclohepta[d]pyrazole-3-carboxylate (PubChem CID 91652121) has the molecular formula C17H25N3O3 and a molecular weight of 319.41 g/mol. Its IUPAC name is 3-(2-oxopiperidin-1-yl)propyl 1,4,5,6,7,8-hexahydrocyclohepta[d]pyrazole-3-carboxylate.
| Compound Name | 3-(2-oxopiperidin-1-yl)propyl 1,4,5,6,7,8-hexahydrocyclohepta[d]pyrazole-3-carboxylate |
|---|---|
| PubChem CID | 91652121 |
| Molecular Formula | C17H25N3O3 |
| Molecular Weight | 319.41 g/mol |
| Exact Mass | 319.19 |
| IUPAC Name | 3-(2-oxopiperidin-1-yl)propyl 1,4,5,6,7,8-hexahydrocyclohepta[d]pyrazole-3-carboxylate |
| SMILES | O=C(OCCCN1CCCCC1=O)c1n[nH]c2c1CCCCC2 |
| InChI | InChI=1S/C17H25N3O3/c21-15-9-4-5-10-20(15)11-6-12-23-17(22)16-13-7-2-1-3-8-14(13)18-19-16/h1-12H2,(H,18,19) |
| InChIKey | QCSBMVIEUNWCOF-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 75.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.41 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|