About [tert-butyl(dimethyl)silyl] pyrazine-2-carboxylate
[tert-butyl(dimethyl)silyl] pyrazine-2-carboxylate (PubChem CID 91727571) has the molecular formula C11H18N2O2Si
and a molecular weight of 238.36 g/mol. Its IUPAC name is [tert-butyl(dimethyl)silyl] pyrazine-2-carboxylate.
Molecular Properties
| Compound Name | [tert-butyl(dimethyl)silyl] pyrazine-2-carboxylate |
| PubChem CID | 91727571 |
| Molecular Formula | C11H18N2O2Si |
| Molecular Weight | 238.36 g/mol |
| Exact Mass | 238.11 |
| IUPAC Name | [tert-butyl(dimethyl)silyl] pyrazine-2-carboxylate |
| SMILES | CC(C)(C)[Si](C)(C)OC(=O)c1cnccn1 |
| InChI | InChI=1S/C11H18N2O2Si/c1-11(2,3)16(4,5)15-10(14)9-8-12-6-7-13-9/h6-8H,1-5H3 |
| InChIKey | QFXIZXULZUGFCH-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.36 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze [tert-butyl(dimethyl)silyl] pyrazine-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [tert-butyl(dimethyl)silyl] pyrazine-2-carboxylate?
The IUPAC name of [tert-butyl(dimethyl)silyl] pyrazine-2-carboxylate (CID 91727571) is [tert-butyl(dimethyl)silyl] pyrazine-2-carboxylate.
What is the SMILES notation for [tert-butyl(dimethyl)silyl] pyrazine-2-carboxylate?
The canonical SMILES for [tert-butyl(dimethyl)silyl] pyrazine-2-carboxylate is CC(C)(C)[Si](C)(C)OC(=O)c1cnccn1.
What is the InChIKey of [tert-butyl(dimethyl)silyl] pyrazine-2-carboxylate?
The InChIKey is QFXIZXULZUGFCH-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18N2O2Si/c1-11(2,3)16(4,5)15-10(14)9-8-12-6-7-13-9/h6-8H,1-5H3.
What are the key properties of [tert-butyl(dimethyl)silyl] pyrazine-2-carboxylate?
[tert-butyl(dimethyl)silyl] pyrazine-2-carboxylate has a molecular weight of 238.36 g/mol, XLogP of 2.64, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [tert-butyl(dimethyl)silyl] pyrazine-2-carboxylate is sourced from PubChem (CID 91727571), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).