About pyrazine-2-carbothioic S-acid
pyrazine-2-carbothioic S-acid (PubChem CID 87249006) has the molecular formula C5H4N2OS
and a molecular weight of 140.17 g/mol. Its IUPAC name is pyrazine-2-carbothioic S-acid.
Molecular Properties
| Compound Name | pyrazine-2-carbothioic S-acid |
| PubChem CID | 87249006 |
| Molecular Formula | C5H4N2OS |
| Molecular Weight | 140.17 g/mol |
| Exact Mass | 140.00 |
| IUPAC Name | pyrazine-2-carbothioic S-acid |
| SMILES | O=C(S)c1cnccn1 |
| InChI | InChI=1S/C5H4N2OS/c8-5(9)4-3-6-1-2-7-4/h1-3H,(H,8,9) |
| InChIKey | PIDQVJYMHMSNJB-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 42.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 140.17 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze pyrazine-2-carbothioic S-acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pyrazine-2-carbothioic S-acid?
The IUPAC name of pyrazine-2-carbothioic S-acid (CID 87249006) is pyrazine-2-carbothioic S-acid.
What is the SMILES notation for pyrazine-2-carbothioic S-acid?
The canonical SMILES for pyrazine-2-carbothioic S-acid is O=C(S)c1cnccn1.
What is the InChIKey of pyrazine-2-carbothioic S-acid?
The InChIKey is PIDQVJYMHMSNJB-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H4N2OS/c8-5(9)4-3-6-1-2-7-4/h1-3H,(H,8,9).
What are the key properties of pyrazine-2-carbothioic S-acid?
pyrazine-2-carbothioic S-acid has a molecular weight of 140.17 g/mol, XLogP of 0.55, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for pyrazine-2-carbothioic S-acid is sourced from PubChem (CID 87249006), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).