potassium;hydride;pyrazine-2-carboxylic acid

C5H5KN2O2 — CID 174693780

IUPACpotassium;hydride;pyrazine-2-carboxylic acid
SMILESO=C(O)c1cnccn1.[H-].[K+]
InChIInChI=1S/C5H4N2O2.K.H/c8-5(9)4-3-6-1-2-7-4;;/h1-3H,(H,8,9);;/q;+1;-1
InChIKeyQLMZVKUYWLKHSZ-UHFFFAOYSA-N
MW164.21 g/mol
LogP-2.71
Rot. Bonds1

About potassium;hydride;pyrazine-2-carboxylic acid

potassium;hydride;pyrazine-2-carboxylic acid (PubChem CID 174693780) has the molecular formula C5H5KN2O2 and a molecular weight of 164.21 g/mol. Its IUPAC name is potassium;hydride;pyrazine-2-carboxylic acid.

Molecular Properties

Compound Namepotassium;hydride;pyrazine-2-carboxylic acid
PubChem CID174693780
Molecular FormulaC5H5KN2O2
Molecular Weight164.21 g/mol
Exact Mass164.00
IUPAC Namepotassium;hydride;pyrazine-2-carboxylic acid
SMILESO=C(O)c1cnccn1.[H-].[K+]
InChIInChI=1S/C5H4N2O2.K.H/c8-5(9)4-3-6-1-2-7-4;;/h1-3H,(H,8,9);;/q;+1;-1
InChIKeyQLMZVKUYWLKHSZ-UHFFFAOYSA-N
XLogP-2.71
TPSA63.08 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms10
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500164.21
LogP ≤ 5-2.71
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze potassium;hydride;pyrazine-2-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of potassium;hydride;pyrazine-2-carboxylic acid?
The IUPAC name of potassium;hydride;pyrazine-2-carboxylic acid (CID 174693780) is potassium;hydride;pyrazine-2-carboxylic acid.
What is the SMILES notation for potassium;hydride;pyrazine-2-carboxylic acid?
The canonical SMILES for potassium;hydride;pyrazine-2-carboxylic acid is O=C(O)c1cnccn1.[H-].[K+].
What is the InChIKey of potassium;hydride;pyrazine-2-carboxylic acid?
The InChIKey is QLMZVKUYWLKHSZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H4N2O2.K.H/c8-5(9)4-3-6-1-2-7-4;;/h1-3H,(H,8,9);;/q;+1;-1.
What are the key properties of potassium;hydride;pyrazine-2-carboxylic acid?
potassium;hydride;pyrazine-2-carboxylic acid has a molecular weight of 164.21 g/mol, XLogP of -2.71, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for potassium;hydride;pyrazine-2-carboxylic acid is sourced from PubChem (CID 174693780), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).