C16H10F4I2N6O2 — CID 139203790
bis(pyrazine-2-carboxamide);1,2,4,5-tetrafluoro-3,6-diiodobenzene (PubChem CID 139203790) has the molecular formula C16H10F4I2N6O2 and a molecular weight of 648.10 g/mol. Its IUPAC name is bis(pyrazine-2-carboxamide);1,2,4,5-tetrafluoro-3,6-diiodobenzene.
| Compound Name | bis(pyrazine-2-carboxamide);1,2,4,5-tetrafluoro-3,6-diiodobenzene |
|---|---|
| PubChem CID | 139203790 |
| Molecular Formula | C16H10F4I2N6O2 |
| Molecular Weight | 648.10 g/mol |
| Exact Mass | 647.89 |
| IUPAC Name | bis(pyrazine-2-carboxamide);1,2,4,5-tetrafluoro-3,6-diiodobenzene |
| SMILES | Fc1c(F)c(I)c(F)c(F)c1I.NC(=O)c1cnccn1.NC(=O)c1cnccn1 |
| InChI | InChI=1S/C6F4I2.2C5H5N3O/c7-1-2(8)6(12)4(10)3(9)5(1)11;2*6-5(9)4-3-7-1-2-8-4/h;2*1-3H,(H2,6,9) |
| InChIKey | QQOLSMDAIRNEIQ-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 137.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.10 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|