About amino(diaminomethylidene)azanium;pyrazine-2-carboxylate
amino(diaminomethylidene)azanium;pyrazine-2-carboxylate (PubChem CID 155803285) has the molecular formula C6H10N6O2
and a molecular weight of 198.19 g/mol. Its IUPAC name is amino(diaminomethylidene)azanium;pyrazine-2-carboxylate.
Molecular Properties
| Compound Name | amino(diaminomethylidene)azanium;pyrazine-2-carboxylate |
| PubChem CID | 155803285 |
| Molecular Formula | C6H10N6O2 |
| Molecular Weight | 198.19 g/mol |
| Exact Mass | 198.09 |
| IUPAC Name | amino(diaminomethylidene)azanium;pyrazine-2-carboxylate |
| SMILES | N[NH+]=C(N)N.O=C([O-])c1cnccn1 |
| InChI | InChI=1S/C5H4N2O2.CH6N4/c8-5(9)4-3-6-1-2-7-4;2-1(3)5-4/h1-3H,(H,8,9);4H2,(H4,2,3,5) |
| InChIKey | AKPKBLWFUYUOHC-UHFFFAOYSA-N |
| XLogP | -4.95 |
| TPSA | 157.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.19 |
| LogP ≤ 5 | -4.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze amino(diaminomethylidene)azanium;pyrazine-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of amino(diaminomethylidene)azanium;pyrazine-2-carboxylate?
The IUPAC name of amino(diaminomethylidene)azanium;pyrazine-2-carboxylate (CID 155803285) is amino(diaminomethylidene)azanium;pyrazine-2-carboxylate.
What is the SMILES notation for amino(diaminomethylidene)azanium;pyrazine-2-carboxylate?
The canonical SMILES for amino(diaminomethylidene)azanium;pyrazine-2-carboxylate is N[NH+]=C(N)N.O=C([O-])c1cnccn1.
What is the InChIKey of amino(diaminomethylidene)azanium;pyrazine-2-carboxylate?
The InChIKey is AKPKBLWFUYUOHC-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H4N2O2.CH6N4/c8-5(9)4-3-6-1-2-7-4;2-1(3)5-4/h1-3H,(H,8,9);4H2,(H4,2,3,5).
What are the key properties of amino(diaminomethylidene)azanium;pyrazine-2-carboxylate?
amino(diaminomethylidene)azanium;pyrazine-2-carboxylate has a molecular weight of 198.19 g/mol, XLogP of -4.95, 1 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for amino(diaminomethylidene)azanium;pyrazine-2-carboxylate is sourced from PubChem (CID 155803285), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).