About pyrazine;pyrazine-2-carbonitrile;pyrazine-2-carboxamide
pyrazine;pyrazine-2-carbonitrile;pyrazine-2-carboxamide (PubChem CID 159756851) has the molecular formula C14H12N8O
and a molecular weight of 308.31 g/mol. Its IUPAC name is pyrazine;pyrazine-2-carbonitrile;pyrazine-2-carboxamide.
Molecular Properties
| Compound Name | pyrazine;pyrazine-2-carbonitrile;pyrazine-2-carboxamide |
| PubChem CID | 159756851 |
| Molecular Formula | C14H12N8O |
| Molecular Weight | 308.31 g/mol |
| Exact Mass | 308.11 |
| IUPAC Name | pyrazine;pyrazine-2-carbonitrile;pyrazine-2-carboxamide |
| SMILES | N#Cc1cnccn1.NC(=O)c1cnccn1.c1cnccn1 |
| InChI | InChI=1S/C5H5N3O.C5H3N3.C4H4N2/c6-5(9)4-3-7-1-2-8-4;6-3-5-4-7-1-2-8-5;1-2-6-4-3-5-1/h1-3H,(H2,6,9);1-2,4H;1-4H |
| InChIKey | NEJKTFLFNOCPHZ-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 144.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.31 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze pyrazine;pyrazine-2-carbonitrile;pyrazine-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pyrazine;pyrazine-2-carbonitrile;pyrazine-2-carboxamide?
The IUPAC name of pyrazine;pyrazine-2-carbonitrile;pyrazine-2-carboxamide (CID 159756851) is pyrazine;pyrazine-2-carbonitrile;pyrazine-2-carboxamide.
What is the SMILES notation for pyrazine;pyrazine-2-carbonitrile;pyrazine-2-carboxamide?
The canonical SMILES for pyrazine;pyrazine-2-carbonitrile;pyrazine-2-carboxamide is N#Cc1cnccn1.NC(=O)c1cnccn1.c1cnccn1.
What is the InChIKey of pyrazine;pyrazine-2-carbonitrile;pyrazine-2-carboxamide?
The InChIKey is NEJKTFLFNOCPHZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H5N3O.C5H3N3.C4H4N2/c6-5(9)4-3-7-1-2-8-4;6-3-5-4-7-1-2-8-5;1-2-6-4-3-5-1/h1-3H,(H2,6,9);1-2,4H;1-4H.
What are the key properties of pyrazine;pyrazine-2-carbonitrile;pyrazine-2-carboxamide?
pyrazine;pyrazine-2-carbonitrile;pyrazine-2-carboxamide has a molecular weight of 308.31 g/mol, XLogP of 0.40, 1 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for pyrazine;pyrazine-2-carbonitrile;pyrazine-2-carboxamide is sourced from PubChem (CID 159756851), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).