C19H18N6O2 — CID 157476260
N-(diaminomethylidene)-4-phenylbenzamide;pyrazine-2-carboxamide (PubChem CID 157476260) has the molecular formula C19H18N6O2 and a molecular weight of 362.39 g/mol. Its IUPAC name is N-(diaminomethylidene)-4-phenylbenzamide;pyrazine-2-carboxamide.
| Compound Name | N-(diaminomethylidene)-4-phenylbenzamide;pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 157476260 |
| Molecular Formula | C19H18N6O2 |
| Molecular Weight | 362.39 g/mol |
| Exact Mass | 362.15 |
| IUPAC Name | N-(diaminomethylidene)-4-phenylbenzamide;pyrazine-2-carboxamide |
| SMILES | NC(=O)c1cnccn1.NC(N)=NC(=O)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C14H13N3O.C5H5N3O/c15-14(16)17-13(18)12-8-6-11(7-9-12)10-4-2-1-3-5-10;6-5(9)4-3-7-1-2-8-4/h1-9H,(H4,15,16,17,18);1-3H,(H2,6,9) |
| InChIKey | BVPXXHINERMXOZ-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 150.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.39 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|