About (benzhydrylideneamino) pyrazine-2-carboxylate
(benzhydrylideneamino) pyrazine-2-carboxylate (PubChem CID 13331734) has the molecular formula C18H13N3O2
and a molecular weight of 303.32 g/mol. Its IUPAC name is (benzhydrylideneamino) pyrazine-2-carboxylate.
Molecular Properties
| Compound Name | (benzhydrylideneamino) pyrazine-2-carboxylate |
| PubChem CID | 13331734 |
| Molecular Formula | C18H13N3O2 |
| Molecular Weight | 303.32 g/mol |
| Exact Mass | 303.10 |
| IUPAC Name | (benzhydrylideneamino) pyrazine-2-carboxylate |
| SMILES | O=C(ON=C(c1ccccc1)c1ccccc1)c1cnccn1 |
| InChI | InChI=1S/C18H13N3O2/c22-18(16-13-19-11-12-20-16)23-21-17(14-7-3-1-4-8-14)15-9-5-2-6-10-15/h1-13H |
| InChIKey | LRUCZVCEYCDFEN-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 64.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.32 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (benzhydrylideneamino) pyrazine-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (benzhydrylideneamino) pyrazine-2-carboxylate?
The IUPAC name of (benzhydrylideneamino) pyrazine-2-carboxylate (CID 13331734) is (benzhydrylideneamino) pyrazine-2-carboxylate.
What is the SMILES notation for (benzhydrylideneamino) pyrazine-2-carboxylate?
The canonical SMILES for (benzhydrylideneamino) pyrazine-2-carboxylate is O=C(ON=C(c1ccccc1)c1ccccc1)c1cnccn1.
What is the InChIKey of (benzhydrylideneamino) pyrazine-2-carboxylate?
The InChIKey is LRUCZVCEYCDFEN-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H13N3O2/c22-18(16-13-19-11-12-20-16)23-21-17(14-7-3-1-4-8-14)15-9-5-2-6-10-15/h1-13H.
What are the key properties of (benzhydrylideneamino) pyrazine-2-carboxylate?
(benzhydrylideneamino) pyrazine-2-carboxylate has a molecular weight of 303.32 g/mol, XLogP of 3.09, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (benzhydrylideneamino) pyrazine-2-carboxylate is sourced from PubChem (CID 13331734), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).