About 1-O-(benzhydrylideneamino) 4-O-[(E)-[phenyl(pyridin-2-yl)methylidene]amino] butanedioate
1-O-(benzhydrylideneamino) 4-O-[(E)-[phenyl(pyridin-2-yl)methylidene]amino] butanedioate (PubChem CID 59685826) has the molecular formula C29H23N3O4
and a molecular weight of 477.52 g/mol. Its IUPAC name is 1-O-(benzhydrylideneamino) 4-O-[(E)-[phenyl(pyridin-2-yl)methylidene]amino] butanedioate.
Molecular Properties
| Compound Name | 1-O-(benzhydrylideneamino) 4-O-[(E)-[phenyl(pyridin-2-yl)methylidene]amino] butanedioate |
| PubChem CID | 59685826 |
| Molecular Formula | C29H23N3O4 |
| Molecular Weight | 477.52 g/mol |
| Exact Mass | 477.17 |
| IUPAC Name | 1-O-(benzhydrylideneamino) 4-O-[(E)-[phenyl(pyridin-2-yl)methylidene]amino] butanedioate |
| SMILES | O=C(CCC(=O)O/N=C(\c1ccccc1)c1ccccn1)ON=C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C29H23N3O4/c33-26(35-31-28(22-12-4-1-5-13-22)23-14-6-2-7-15-23)19-20-27(34)36-32-29(24-16-8-3-9-17-24)25-18-10-11-21-30-25/h1-18,21H,19-20H2/b32-29+ |
| InChIKey | BLSCTOZFUONEPQ-UUDCSCGESA-N |
| XLogP | 5.15 |
| TPSA | 90.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 477.52 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-O-(benzhydrylideneamino) 4-O-[(E)-[phenyl(pyridin-2-yl)methylidene]amino] butanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-O-(benzhydrylideneamino) 4-O-[(E)-[phenyl(pyridin-2-yl)methylidene]amino] butanedioate?
The IUPAC name of 1-O-(benzhydrylideneamino) 4-O-[(E)-[phenyl(pyridin-2-yl)methylidene]amino] butanedioate (CID 59685826) is 1-O-(benzhydrylideneamino) 4-O-[(E)-[phenyl(pyridin-2-yl)methylidene]amino] butanedioate.
What is the SMILES notation for 1-O-(benzhydrylideneamino) 4-O-[(E)-[phenyl(pyridin-2-yl)methylidene]amino] butanedioate?
The canonical SMILES for 1-O-(benzhydrylideneamino) 4-O-[(E)-[phenyl(pyridin-2-yl)methylidene]amino] butanedioate is O=C(CCC(=O)O/N=C(\c1ccccc1)c1ccccn1)ON=C(c1ccccc1)c1ccccc1.
What is the InChIKey of 1-O-(benzhydrylideneamino) 4-O-[(E)-[phenyl(pyridin-2-yl)methylidene]amino] butanedioate?
The InChIKey is BLSCTOZFUONEPQ-UUDCSCGESA-N. The full InChI is InChI=1S/C29H23N3O4/c33-26(35-31-28(22-12-4-1-5-13-22)23-14-6-2-7-15-23)19-20-27(34)36-32-29(24-16-8-3-9-17-24)25-18-10-11-21-30-25/h1-18,21H,19-20H2/b32-29+.
What are the key properties of 1-O-(benzhydrylideneamino) 4-O-[(E)-[phenyl(pyridin-2-yl)methylidene]amino] butanedioate?
1-O-(benzhydrylideneamino) 4-O-[(E)-[phenyl(pyridin-2-yl)methylidene]amino] butanedioate has a molecular weight of 477.52 g/mol, XLogP of 5.15, 9 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 1-O-(benzhydrylideneamino) 4-O-[(E)-[phenyl(pyridin-2-yl)methylidene]amino] butanedioate is sourced from PubChem (CID 59685826), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).