C21H27N3O2 — CID 19918393
[(Z)-[phenyl(pyridin-2-yl)methylidene]amino] N-octylcarbamate (PubChem CID 19918393) has the molecular formula C21H27N3O2 and a molecular weight of 353.47 g/mol. Its IUPAC name is [(Z)-[phenyl(pyridin-2-yl)methylidene]amino] N-octylcarbamate.
| Compound Name | [(Z)-[phenyl(pyridin-2-yl)methylidene]amino] N-octylcarbamate |
|---|---|
| PubChem CID | 19918393 |
| Molecular Formula | C21H27N3O2 |
| Molecular Weight | 353.47 g/mol |
| Exact Mass | 353.21 |
| IUPAC Name | [(Z)-[phenyl(pyridin-2-yl)methylidene]amino] N-octylcarbamate |
| SMILES | CCCCCCCCNC(=O)O/N=C(/c1ccccc1)c1ccccn1 |
| InChI | InChI=1S/C21H27N3O2/c1-2-3-4-5-6-11-17-23-21(25)26-24-20(18-13-8-7-9-14-18)19-15-10-12-16-22-19/h7-10,12-16H,2-6,11,17H2,1H3,(H,23,25)/b24-20- |
| InChIKey | YWLHOOLNUBNINK-GFMRDNFCSA-N |
| XLogP | 4.92 |
| TPSA | 63.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.47 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|