C18H23ClN4O2 — CID 54601367
N-[6-(pyridine-2-carbonylamino)hexyl]pyridine-2-carboxamide;hydrochloride (PubChem CID 54601367) has the molecular formula C18H23ClN4O2 and a molecular weight of 362.86 g/mol. Its IUPAC name is N-[6-(pyridine-2-carbonylamino)hexyl]pyridine-2-carboxamide;hydrochloride.
| Compound Name | N-[6-(pyridine-2-carbonylamino)hexyl]pyridine-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 54601367 |
| Molecular Formula | C18H23ClN4O2 |
| Molecular Weight | 362.86 g/mol |
| Exact Mass | 362.15 |
| IUPAC Name | N-[6-(pyridine-2-carbonylamino)hexyl]pyridine-2-carboxamide;hydrochloride |
| SMILES | Cl.O=C(NCCCCCCNC(=O)c1ccccn1)c1ccccn1 |
| InChI | InChI=1S/C18H22N4O2.ClH/c23-17(15-9-3-7-11-19-15)21-13-5-1-2-6-14-22-18(24)16-10-4-8-12-20-16;/h3-4,7-12H,1-2,5-6,13-14H2,(H,21,23)(H,22,24);1H |
| InChIKey | KYXUMMSLNDYNSR-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.86 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|