C12H17BrN2O — CID 106157892
N-(5-bromo-4-methylpentyl)pyridine-2-carboxamide (PubChem CID 106157892) has the molecular formula C12H17BrN2O and a molecular weight of 285.18 g/mol. Its IUPAC name is N-(5-bromo-4-methylpentyl)pyridine-2-carboxamide.
| Compound Name | N-(5-bromo-4-methylpentyl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 106157892 |
| Molecular Formula | C12H17BrN2O |
| Molecular Weight | 285.18 g/mol |
| Exact Mass | 284.05 |
| IUPAC Name | N-(5-bromo-4-methylpentyl)pyridine-2-carboxamide |
| SMILES | CC(CBr)CCCNC(=O)c1ccccn1 |
| InChI | InChI=1S/C12H17BrN2O/c1-10(9-13)5-4-8-15-12(16)11-6-2-3-7-14-11/h2-3,6-7,10H,4-5,8-9H2,1H3,(H,15,16) |
| InChIKey | VIFDWQBVXSMDCN-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.18 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|