C18H23N3O — CID 26478
N,N-diethyl-2-[[phenyl(pyridin-2-yl)methylidene]amino]oxyethanamine (PubChem CID 26478) has the molecular formula C18H23N3O and a molecular weight of 297.40 g/mol. Its IUPAC name is N,N-diethyl-2-[[phenyl(pyridin-2-yl)methylidene]amino]oxyethanamine.
| Compound Name | N,N-diethyl-2-[[phenyl(pyridin-2-yl)methylidene]amino]oxyethanamine |
|---|---|
| PubChem CID | 26478 |
| Molecular Formula | C18H23N3O |
| Molecular Weight | 297.40 g/mol |
| Exact Mass | 297.18 |
| IUPAC Name | N,N-diethyl-2-[[phenyl(pyridin-2-yl)methylidene]amino]oxyethanamine |
| SMILES | CCN(CC)CCON=C(c1ccccc1)c1ccccn1 |
| InChI | InChI=1S/C18H23N3O/c1-3-21(4-2)14-15-22-20-18(16-10-6-5-7-11-16)17-12-8-9-13-19-17/h5-13H,3-4,14-15H2,1-2H3 |
| InChIKey | LURHNZKIXLOLQK-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 37.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.40 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|