C22H26FN3O9 — CID 73449276
N,N-diethyl-2-[[(4-fluorophenyl)-pyridin-3-ylmethylidene]amino]oxyethanamine;oxalic acid (PubChem CID 73449276) has the molecular formula C22H26FN3O9 and a molecular weight of 495.46 g/mol. Its IUPAC name is N,N-diethyl-2-[[(4-fluorophenyl)-pyridin-3-ylmethylidene]amino]oxyethanamine;oxalic acid.
| Compound Name | N,N-diethyl-2-[[(4-fluorophenyl)-pyridin-3-ylmethylidene]amino]oxyethanamine;oxalic acid |
|---|---|
| PubChem CID | 73449276 |
| Molecular Formula | C22H26FN3O9 |
| Molecular Weight | 495.46 g/mol |
| Exact Mass | 495.17 |
| IUPAC Name | N,N-diethyl-2-[[(4-fluorophenyl)-pyridin-3-ylmethylidene]amino]oxyethanamine;oxalic acid |
| SMILES | CCN(CC)CCON=C(c1ccc(F)cc1)c1cccnc1.O=C(O)C(=O)O.O=C(O)C(=O)O |
| InChI | InChI=1S/C18H22FN3O.2C2H2O4/c1-3-22(4-2)12-13-23-21-18(16-6-5-11-20-14-16)15-7-9-17(19)10-8-15;2*3-1(4)2(5)6/h5-11,14H,3-4,12-13H2,1-2H3;2*(H,3,4)(H,5,6) |
| InChIKey | MUMDQFVBJZTMKD-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 186.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.46 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|