C20H22FN3O9 — CID 73449275
2-[[(4-fluorophenyl)-pyridin-3-ylmethylidene]amino]oxy-N,N-dimethylethanamine;oxalic acid (PubChem CID 73449275) has the molecular formula C20H22FN3O9 and a molecular weight of 467.41 g/mol. Its IUPAC name is 2-[[(4-fluorophenyl)-pyridin-3-ylmethylidene]amino]oxy-N,N-dimethylethanamine;oxalic acid.
| Compound Name | 2-[[(4-fluorophenyl)-pyridin-3-ylmethylidene]amino]oxy-N,N-dimethylethanamine;oxalic acid |
|---|---|
| PubChem CID | 73449275 |
| Molecular Formula | C20H22FN3O9 |
| Molecular Weight | 467.41 g/mol |
| Exact Mass | 467.13 |
| IUPAC Name | 2-[[(4-fluorophenyl)-pyridin-3-ylmethylidene]amino]oxy-N,N-dimethylethanamine;oxalic acid |
| SMILES | CN(C)CCON=C(c1ccc(F)cc1)c1cccnc1.O=C(O)C(=O)O.O=C(O)C(=O)O |
| InChI | InChI=1S/C16H18FN3O.2C2H2O4/c1-20(2)10-11-21-19-16(14-4-3-9-18-12-14)13-5-7-15(17)8-6-13;2*3-1(4)2(5)6/h3-9,12H,10-11H2,1-2H3;2*(H,3,4)(H,5,6) |
| InChIKey | IZYLGPXSQHLHHG-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 186.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.41 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|