C23H22N2O4 — CID 54181595
2-[3-[3-[[phenyl(pyridin-3-yl)methylidene]amino]oxypropyl]phenoxy]acetic acid (PubChem CID 54181595) has the molecular formula C23H22N2O4 and a molecular weight of 390.44 g/mol. Its IUPAC name is 2-[3-[3-[[phenyl(pyridin-3-yl)methylidene]amino]oxypropyl]phenoxy]acetic acid.
| Compound Name | 2-[3-[3-[[phenyl(pyridin-3-yl)methylidene]amino]oxypropyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 54181595 |
| Molecular Formula | C23H22N2O4 |
| Molecular Weight | 390.44 g/mol |
| Exact Mass | 390.16 |
| IUPAC Name | 2-[3-[3-[[phenyl(pyridin-3-yl)methylidene]amino]oxypropyl]phenoxy]acetic acid |
| SMILES | O=C(O)COc1cccc(CCCON=C(c2ccccc2)c2cccnc2)c1 |
| InChI | InChI=1S/C23H22N2O4/c26-22(27)17-28-21-12-4-7-18(15-21)8-6-14-29-25-23(19-9-2-1-3-10-19)20-11-5-13-24-16-20/h1-5,7,9-13,15-16H,6,8,14,17H2,(H,26,27) |
| InChIKey | PCENDIVMXZTYHZ-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 81.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.44 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|