C23H28O6 — CID 57013169
4-oxo-4-[3-[3-(4-phenoxybutoxy)phenyl]propoxy]butanoic acid (PubChem CID 57013169) has the molecular formula C23H28O6 and a molecular weight of 400.47 g/mol. Its IUPAC name is 4-oxo-4-[3-[3-(4-phenoxybutoxy)phenyl]propoxy]butanoic acid.
| Compound Name | 4-oxo-4-[3-[3-(4-phenoxybutoxy)phenyl]propoxy]butanoic acid |
|---|---|
| PubChem CID | 57013169 |
| Molecular Formula | C23H28O6 |
| Molecular Weight | 400.47 g/mol |
| Exact Mass | 400.19 |
| IUPAC Name | 4-oxo-4-[3-[3-(4-phenoxybutoxy)phenyl]propoxy]butanoic acid |
| SMILES | O=C(O)CCC(=O)OCCCc1cccc(OCCCCOc2ccccc2)c1 |
| InChI | InChI=1S/C23H28O6/c24-22(25)13-14-23(26)29-17-7-9-19-8-6-12-21(18-19)28-16-5-4-15-27-20-10-2-1-3-11-20/h1-3,6,8,10-12,18H,4-5,7,9,13-17H2,(H,24,25) |
| InChIKey | SXKAMLDUTQEPQO-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.47 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|