C27H29NO6 — CID 57247478
3-[3-[3-(4-phenoxybutoxy)phenyl]propoxycarbamoyl]benzoic acid (PubChem CID 57247478) has the molecular formula C27H29NO6 and a molecular weight of 463.53 g/mol. Its IUPAC name is 3-[3-[3-(4-phenoxybutoxy)phenyl]propoxycarbamoyl]benzoic acid.
| Compound Name | 3-[3-[3-(4-phenoxybutoxy)phenyl]propoxycarbamoyl]benzoic acid |
|---|---|
| PubChem CID | 57247478 |
| Molecular Formula | C27H29NO6 |
| Molecular Weight | 463.53 g/mol |
| Exact Mass | 463.20 |
| IUPAC Name | 3-[3-[3-(4-phenoxybutoxy)phenyl]propoxycarbamoyl]benzoic acid |
| SMILES | O=C(O)c1cccc(C(=O)NOCCCc2cccc(OCCCCOc3ccccc3)c2)c1 |
| InChI | InChI=1S/C27H29NO6/c29-26(22-11-7-12-23(20-22)27(30)31)28-34-18-8-10-21-9-6-15-25(19-21)33-17-5-4-16-32-24-13-2-1-3-14-24/h1-3,6-7,9,11-15,19-20H,4-5,8,10,16-18H2,(H,28,29)(H,30,31) |
| InChIKey | DDAVUWLPQAZVDQ-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 94.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.53 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|