C38H44N2O4 — CID 17233441
3-(2-phenylethoxy)-N-[8-[[3-(2-phenylethoxy)benzoyl]amino]octyl]benzamide (PubChem CID 17233441) has the molecular formula C38H44N2O4 and a molecular weight of 592.78 g/mol. Its IUPAC name is 3-(2-phenylethoxy)-N-[8-[[3-(2-phenylethoxy)benzoyl]amino]octyl]benzamide.
| Compound Name | 3-(2-phenylethoxy)-N-[8-[[3-(2-phenylethoxy)benzoyl]amino]octyl]benzamide |
|---|---|
| PubChem CID | 17233441 |
| Molecular Formula | C38H44N2O4 |
| Molecular Weight | 592.78 g/mol |
| Exact Mass | 592.33 |
| IUPAC Name | 3-(2-phenylethoxy)-N-[8-[[3-(2-phenylethoxy)benzoyl]amino]octyl]benzamide |
| SMILES | O=C(NCCCCCCCCNC(=O)c1cccc(OCCc2ccccc2)c1)c1cccc(OCCc2ccccc2)c1 |
| InChI | InChI=1S/C38H44N2O4/c41-37(33-19-13-21-35(29-33)43-27-23-31-15-7-5-8-16-31)39-25-11-3-1-2-4-12-26-40-38(42)34-20-14-22-36(30-34)44-28-24-32-17-9-6-10-18-32/h5-10,13-22,29-30H,1-4,11-12,23-28H2,(H,39,41)(H,40,42) |
| InChIKey | ARHOTCXSBQXVCE-UHFFFAOYSA-N |
| XLogP | 7.43 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.78 |
| LogP ≤ 5 | 7.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|