C26H27N3O4S — CID 17219345
N-(2-methoxyethyl)-3-[[3-(2-phenylethoxy)benzoyl]carbamothioylamino]benzamide (PubChem CID 17219345) has the molecular formula C26H27N3O4S and a molecular weight of 477.59 g/mol. Its IUPAC name is N-(2-methoxyethyl)-3-[[3-(2-phenylethoxy)benzoyl]carbamothioylamino]benzamide.
| Compound Name | N-(2-methoxyethyl)-3-[[3-(2-phenylethoxy)benzoyl]carbamothioylamino]benzamide |
|---|---|
| PubChem CID | 17219345 |
| Molecular Formula | C26H27N3O4S |
| Molecular Weight | 477.59 g/mol |
| Exact Mass | 477.17 |
| IUPAC Name | N-(2-methoxyethyl)-3-[[3-(2-phenylethoxy)benzoyl]carbamothioylamino]benzamide |
| SMILES | COCCNC(=O)c1cccc(NC(=S)NC(=O)c2cccc(OCCc3ccccc3)c2)c1 |
| InChI | InChI=1S/C26H27N3O4S/c1-32-16-14-27-24(30)20-9-5-11-22(17-20)28-26(34)29-25(31)21-10-6-12-23(18-21)33-15-13-19-7-3-2-4-8-19/h2-12,17-18H,13-16H2,1H3,(H,27,30)(H2,28,29,31,34) |
| InChIKey | BREXRFWBKLHJJV-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 88.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.59 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|