C33H33N3O3S — CID 17232553
N-[[3-[(4-tert-butylbenzoyl)amino]phenyl]carbamothioyl]-3-(2-phenylethoxy)benzamide (PubChem CID 17232553) has the molecular formula C33H33N3O3S and a molecular weight of 551.71 g/mol. Its IUPAC name is N-[[3-[(4-tert-butylbenzoyl)amino]phenyl]carbamothioyl]-3-(2-phenylethoxy)benzamide.
| Compound Name | N-[[3-[(4-tert-butylbenzoyl)amino]phenyl]carbamothioyl]-3-(2-phenylethoxy)benzamide |
|---|---|
| PubChem CID | 17232553 |
| Molecular Formula | C33H33N3O3S |
| Molecular Weight | 551.71 g/mol |
| Exact Mass | 551.22 |
| IUPAC Name | N-[[3-[(4-tert-butylbenzoyl)amino]phenyl]carbamothioyl]-3-(2-phenylethoxy)benzamide |
| SMILES | CC(C)(C)c1ccc(C(=O)Nc2cccc(NC(=S)NC(=O)c3cccc(OCCc4ccccc4)c3)c2)cc1 |
| InChI | InChI=1S/C33H33N3O3S/c1-33(2,3)26-17-15-24(16-18-26)30(37)34-27-12-8-13-28(22-27)35-32(40)36-31(38)25-11-7-14-29(21-25)39-20-19-23-9-5-4-6-10-23/h4-18,21-22H,19-20H2,1-3H3,(H,34,37)(H2,35,36,38,40) |
| InChIKey | OOHOUOWQKGANCK-UHFFFAOYSA-N |
| XLogP | 6.98 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.71 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|