C34H34N4O4S — CID 17134859
N-[[[4-[(4-tert-butylbenzoyl)amino]benzoyl]amino]carbamothioyl]-3-(2-phenylethoxy)benzamide (PubChem CID 17134859) has the molecular formula C34H34N4O4S and a molecular weight of 594.74 g/mol. Its IUPAC name is N-[[[4-[(4-tert-butylbenzoyl)amino]benzoyl]amino]carbamothioyl]-3-(2-phenylethoxy)benzamide.
| Compound Name | N-[[[4-[(4-tert-butylbenzoyl)amino]benzoyl]amino]carbamothioyl]-3-(2-phenylethoxy)benzamide |
|---|---|
| PubChem CID | 17134859 |
| Molecular Formula | C34H34N4O4S |
| Molecular Weight | 594.74 g/mol |
| Exact Mass | 594.23 |
| IUPAC Name | N-[[[4-[(4-tert-butylbenzoyl)amino]benzoyl]amino]carbamothioyl]-3-(2-phenylethoxy)benzamide |
| SMILES | CC(C)(C)c1ccc(C(=O)Nc2ccc(C(=O)NNC(=S)NC(=O)c3cccc(OCCc4ccccc4)c3)cc2)cc1 |
| InChI | InChI=1S/C34H34N4O4S/c1-34(2,3)27-16-12-24(13-17-27)30(39)35-28-18-14-25(15-19-28)32(41)37-38-33(43)36-31(40)26-10-7-11-29(22-26)42-21-20-23-8-5-4-6-9-23/h4-19,22H,20-21H2,1-3H3,(H,35,39)(H,37,41)(H2,36,38,40,43) |
| InChIKey | RKHJJCYZKICCGP-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 108.56 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.74 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|