C26H27NO3 — CID 17133137
3-(2-methylprop-2-enoxy)-N-[4-(3-phenylpropoxy)phenyl]benzamide (PubChem CID 17133137) has the molecular formula C26H27NO3 and a molecular weight of 401.51 g/mol. Its IUPAC name is 3-(2-methylprop-2-enoxy)-N-[4-(3-phenylpropoxy)phenyl]benzamide.
| Compound Name | 3-(2-methylprop-2-enoxy)-N-[4-(3-phenylpropoxy)phenyl]benzamide |
|---|---|
| PubChem CID | 17133137 |
| Molecular Formula | C26H27NO3 |
| Molecular Weight | 401.51 g/mol |
| Exact Mass | 401.20 |
| IUPAC Name | 3-(2-methylprop-2-enoxy)-N-[4-(3-phenylpropoxy)phenyl]benzamide |
| SMILES | C=C(C)COc1cccc(C(=O)Nc2ccc(OCCCc3ccccc3)cc2)c1 |
| InChI | InChI=1S/C26H27NO3/c1-20(2)19-30-25-12-6-11-22(18-25)26(28)27-23-13-15-24(16-14-23)29-17-7-10-21-8-4-3-5-9-21/h3-6,8-9,11-16,18H,1,7,10,17,19H2,2H3,(H,27,28) |
| InChIKey | NYCCTSUTKOGBBA-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.51 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|