C18H18O6S — CID 123109736
3-[[2-oxo-2-(2-phenoxyethoxy)ethyl]sulfinylmethyl]benzoic acid (PubChem CID 123109736) has the molecular formula C18H18O6S and a molecular weight of 362.40 g/mol. Its IUPAC name is 3-[[2-oxo-2-(2-phenoxyethoxy)ethyl]sulfinylmethyl]benzoic acid.
| Compound Name | 3-[[2-oxo-2-(2-phenoxyethoxy)ethyl]sulfinylmethyl]benzoic acid |
|---|---|
| PubChem CID | 123109736 |
| Molecular Formula | C18H18O6S |
| Molecular Weight | 362.40 g/mol |
| Exact Mass | 362.08 |
| IUPAC Name | 3-[[2-oxo-2-(2-phenoxyethoxy)ethyl]sulfinylmethyl]benzoic acid |
| SMILES | O=C(CS(=O)Cc1cccc(C(=O)O)c1)OCCOc1ccccc1 |
| InChI | InChI=1S/C18H18O6S/c19-17(24-10-9-23-16-7-2-1-3-8-16)13-25(22)12-14-5-4-6-15(11-14)18(20)21/h1-8,11H,9-10,12-13H2,(H,20,21) |
| InChIKey | TULJYZJEBQSZIQ-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.40 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|