C48H44O12 — CID 167602955
bis(2-phenoxyethyl) benzene-1,2-dicarboxylate;bis(2-phenoxyethyl) benzene-1,3-dicarboxylate (PubChem CID 167602955) has the molecular formula C48H44O12 and a molecular weight of 812.87 g/mol. Its IUPAC name is bis(2-phenoxyethyl) benzene-1,2-dicarboxylate;bis(2-phenoxyethyl) benzene-1,3-dicarboxylate.
| Compound Name | bis(2-phenoxyethyl) benzene-1,2-dicarboxylate;bis(2-phenoxyethyl) benzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 167602955 |
| Molecular Formula | C48H44O12 |
| Molecular Weight | 812.87 g/mol |
| Exact Mass | 812.28 |
| IUPAC Name | bis(2-phenoxyethyl) benzene-1,2-dicarboxylate;bis(2-phenoxyethyl) benzene-1,3-dicarboxylate |
| SMILES | O=C(OCCOc1ccccc1)c1cccc(C(=O)OCCOc2ccccc2)c1.O=C(OCCOc1ccccc1)c1ccccc1C(=O)OCCOc1ccccc1 |
| InChI | InChI=1S/2C24H22O6/c25-23(29-16-14-27-21-10-3-1-4-11-21)19-8-7-9-20(18-19)24(26)30-17-15-28-22-12-5-2-6-13-22;25-23(29-17-15-27-19-9-3-1-4-10-19)21-13-7-8-14-22(21)24(26)30-18-16-28-20-11-5-2-6-12-20/h1-13,18H,14-17H2;1-14H,15-18H2 |
| InChIKey | JZFZUHFVXJMZOU-UHFFFAOYSA-N |
| XLogP | 8.32 |
| TPSA | 142.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 60 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 812.87 |
| LogP ≤ 5 | 8.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|