About 2-phenoxyethyl 3-sulfanylbenzoate
2-phenoxyethyl 3-sulfanylbenzoate (PubChem CID 107018511) has the molecular formula C15H14O3S
and a molecular weight of 274.34 g/mol. Its IUPAC name is 2-phenoxyethyl 3-sulfanylbenzoate.
Molecular Properties
| Compound Name | 2-phenoxyethyl 3-sulfanylbenzoate |
| PubChem CID | 107018511 |
| Molecular Formula | C15H14O3S |
| Molecular Weight | 274.34 g/mol |
| Exact Mass | 274.07 |
| IUPAC Name | 2-phenoxyethyl 3-sulfanylbenzoate |
| SMILES | O=C(OCCOc1ccccc1)c1cccc(S)c1 |
| InChI | InChI=1S/C15H14O3S/c16-15(12-5-4-8-14(19)11-12)18-10-9-17-13-6-2-1-3-7-13/h1-8,11,19H,9-10H2 |
| InChIKey | MSIDABFDYMUTIF-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 35.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.34 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 2-phenoxyethyl 3-sulfanylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-phenoxyethyl 3-sulfanylbenzoate?
The IUPAC name of 2-phenoxyethyl 3-sulfanylbenzoate (CID 107018511) is 2-phenoxyethyl 3-sulfanylbenzoate.
What is the SMILES notation for 2-phenoxyethyl 3-sulfanylbenzoate?
The canonical SMILES for 2-phenoxyethyl 3-sulfanylbenzoate is O=C(OCCOc1ccccc1)c1cccc(S)c1.
What is the InChIKey of 2-phenoxyethyl 3-sulfanylbenzoate?
The InChIKey is MSIDABFDYMUTIF-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H14O3S/c16-15(12-5-4-8-14(19)11-12)18-10-9-17-13-6-2-1-3-7-13/h1-8,11,19H,9-10H2.
What are the key properties of 2-phenoxyethyl 3-sulfanylbenzoate?
2-phenoxyethyl 3-sulfanylbenzoate has a molecular weight of 274.34 g/mol, XLogP of 3.21, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-phenoxyethyl 3-sulfanylbenzoate is sourced from PubChem (CID 107018511), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).