C17H16O5S — CID 123109865
3-[(2-methoxy-2-oxo-1-phenylethyl)sulfinylmethyl]benzoic acid (PubChem CID 123109865) has the molecular formula C17H16O5S and a molecular weight of 332.38 g/mol. Its IUPAC name is 3-[(2-methoxy-2-oxo-1-phenylethyl)sulfinylmethyl]benzoic acid.
| Compound Name | 3-[(2-methoxy-2-oxo-1-phenylethyl)sulfinylmethyl]benzoic acid |
|---|---|
| PubChem CID | 123109865 |
| Molecular Formula | C17H16O5S |
| Molecular Weight | 332.38 g/mol |
| Exact Mass | 332.07 |
| IUPAC Name | 3-[(2-methoxy-2-oxo-1-phenylethyl)sulfinylmethyl]benzoic acid |
| SMILES | COC(=O)C(c1ccccc1)S(=O)Cc1cccc(C(=O)O)c1 |
| InChI | InChI=1S/C17H16O5S/c1-22-17(20)15(13-7-3-2-4-8-13)23(21)11-12-6-5-9-14(10-12)16(18)19/h2-10,15H,11H2,1H3,(H,18,19) |
| InChIKey | RGXMTDIELLXJFX-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.38 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |