C18H17NO6S — CID 123109907
4-[[2-[(3-methoxycarbonylphenyl)methylsulfinyl]acetyl]amino]benzoic acid (PubChem CID 123109907) has the molecular formula C18H17NO6S and a molecular weight of 375.40 g/mol. Its IUPAC name is 4-[[2-[(3-methoxycarbonylphenyl)methylsulfinyl]acetyl]amino]benzoic acid.
| Compound Name | 4-[[2-[(3-methoxycarbonylphenyl)methylsulfinyl]acetyl]amino]benzoic acid |
|---|---|
| PubChem CID | 123109907 |
| Molecular Formula | C18H17NO6S |
| Molecular Weight | 375.40 g/mol |
| Exact Mass | 375.08 |
| IUPAC Name | 4-[[2-[(3-methoxycarbonylphenyl)methylsulfinyl]acetyl]amino]benzoic acid |
| SMILES | COC(=O)c1cccc(CS(=O)CC(=O)Nc2ccc(C(=O)O)cc2)c1 |
| InChI | InChI=1S/C18H17NO6S/c1-25-18(23)14-4-2-3-12(9-14)10-26(24)11-16(20)19-15-7-5-13(6-8-15)17(21)22/h2-9H,10-11H2,1H3,(H,19,20)(H,21,22) |
| InChIKey | APJOEGAWJLMGGS-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 109.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.40 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |