C16H17NO2S — CID 95169335
2-[(R)-benzylsulfinyl]-N-(4-methylphenyl)acetamide (PubChem CID 95169335) has the molecular formula C16H17NO2S and a molecular weight of 287.38 g/mol. Its IUPAC name is 2-[(R)-benzylsulfinyl]-N-(4-methylphenyl)acetamide.
| Compound Name | 2-[(R)-benzylsulfinyl]-N-(4-methylphenyl)acetamide |
|---|---|
| PubChem CID | 95169335 |
| Molecular Formula | C16H17NO2S |
| Molecular Weight | 287.38 g/mol |
| Exact Mass | 287.10 |
| IUPAC Name | 2-[(R)-benzylsulfinyl]-N-(4-methylphenyl)acetamide |
| SMILES | Cc1ccc(NC(=O)C[S@](=O)Cc2ccccc2)cc1 |
| InChI | InChI=1S/C16H17NO2S/c1-13-7-9-15(10-8-13)17-16(18)12-20(19)11-14-5-3-2-4-6-14/h2-10H,11-12H2,1H3,(H,17,18)/t20-/m1/s1 |
| InChIKey | UDWFJXDCZKCWPX-HXUWFJFHSA-N |
| XLogP | 2.88 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.38 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |