C17H16N2O4 — CID 108952857
methyl 3-[(3-anilino-3-oxopropanoyl)amino]benzoate (PubChem CID 108952857) has the molecular formula C17H16N2O4 and a molecular weight of 312.33 g/mol. Its IUPAC name is methyl 3-[(3-anilino-3-oxopropanoyl)amino]benzoate.
| Compound Name | methyl 3-[(3-anilino-3-oxopropanoyl)amino]benzoate |
|---|---|
| PubChem CID | 108952857 |
| Molecular Formula | C17H16N2O4 |
| Molecular Weight | 312.33 g/mol |
| Exact Mass | 312.11 |
| IUPAC Name | methyl 3-[(3-anilino-3-oxopropanoyl)amino]benzoate |
| SMILES | COC(=O)c1cccc(NC(=O)CC(=O)Nc2ccccc2)c1 |
| InChI | InChI=1S/C17H16N2O4/c1-23-17(22)12-6-5-9-14(10-12)19-16(21)11-15(20)18-13-7-3-2-4-8-13/h2-10H,11H2,1H3,(H,18,20)(H,19,21) |
| InChIKey | YTRSEKAOWQVCAU-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.33 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|