C19H21N3O4 — CID 108956329
methyl 3-[[3-[4-(dimethylamino)anilino]-3-oxopropanoyl]amino]benzoate (PubChem CID 108956329) has the molecular formula C19H21N3O4 and a molecular weight of 355.39 g/mol. Its IUPAC name is methyl 3-[[3-[4-(dimethylamino)anilino]-3-oxopropanoyl]amino]benzoate.
| Compound Name | methyl 3-[[3-[4-(dimethylamino)anilino]-3-oxopropanoyl]amino]benzoate |
|---|---|
| PubChem CID | 108956329 |
| Molecular Formula | C19H21N3O4 |
| Molecular Weight | 355.39 g/mol |
| Exact Mass | 355.15 |
| IUPAC Name | methyl 3-[[3-[4-(dimethylamino)anilino]-3-oxopropanoyl]amino]benzoate |
| SMILES | COC(=O)c1cccc(NC(=O)CC(=O)Nc2ccc(N(C)C)cc2)c1 |
| InChI | InChI=1S/C19H21N3O4/c1-22(2)16-9-7-14(8-10-16)20-17(23)12-18(24)21-15-6-4-5-13(11-15)19(25)26-3/h4-11H,12H2,1-3H3,(H,20,23)(H,21,24) |
| InChIKey | SABJXGOCMUZWDJ-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.39 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|