C17H14F2N2O4 — CID 108956359
methyl 3-[[3-(3,4-difluoroanilino)-3-oxopropanoyl]amino]benzoate (PubChem CID 108956359) has the molecular formula C17H14F2N2O4 and a molecular weight of 348.31 g/mol. Its IUPAC name is methyl 3-[[3-(3,4-difluoroanilino)-3-oxopropanoyl]amino]benzoate.
| Compound Name | methyl 3-[[3-(3,4-difluoroanilino)-3-oxopropanoyl]amino]benzoate |
|---|---|
| PubChem CID | 108956359 |
| Molecular Formula | C17H14F2N2O4 |
| Molecular Weight | 348.31 g/mol |
| Exact Mass | 348.09 |
| IUPAC Name | methyl 3-[[3-(3,4-difluoroanilino)-3-oxopropanoyl]amino]benzoate |
| SMILES | COC(=O)c1cccc(NC(=O)CC(=O)Nc2ccc(F)c(F)c2)c1 |
| InChI | InChI=1S/C17H14F2N2O4/c1-25-17(24)10-3-2-4-11(7-10)20-15(22)9-16(23)21-12-5-6-13(18)14(19)8-12/h2-8H,9H2,1H3,(H,20,22)(H,21,23) |
| InChIKey | OCXWEVQAJNXERV-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.31 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|