C16H15FN2O2S — CID 46627843
methyl 3-[(3-fluoro-4-methylphenyl)carbamothioylamino]benzoate (PubChem CID 46627843) has the molecular formula C16H15FN2O2S and a molecular weight of 318.37 g/mol. Its IUPAC name is methyl 3-[(3-fluoro-4-methylphenyl)carbamothioylamino]benzoate.
| Compound Name | methyl 3-[(3-fluoro-4-methylphenyl)carbamothioylamino]benzoate |
|---|---|
| PubChem CID | 46627843 |
| Molecular Formula | C16H15FN2O2S |
| Molecular Weight | 318.37 g/mol |
| Exact Mass | 318.08 |
| IUPAC Name | methyl 3-[(3-fluoro-4-methylphenyl)carbamothioylamino]benzoate |
| SMILES | COC(=O)c1cccc(NC(=S)Nc2ccc(C)c(F)c2)c1 |
| InChI | InChI=1S/C16H15FN2O2S/c1-10-6-7-13(9-14(10)17)19-16(22)18-12-5-3-4-11(8-12)15(20)21-2/h3-9H,1-2H3,(H2,18,19,22) |
| InChIKey | JSIPOEYBZNXMGG-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.37 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|