C19H22N2O2S — CID 100729887
methyl 3-[[(1S)-1-(3,4-dimethylphenyl)ethyl]carbamothioylamino]benzoate (PubChem CID 100729887) has the molecular formula C19H22N2O2S and a molecular weight of 342.46 g/mol. Its IUPAC name is methyl 3-[[(1S)-1-(3,4-dimethylphenyl)ethyl]carbamothioylamino]benzoate.
| Compound Name | methyl 3-[[(1S)-1-(3,4-dimethylphenyl)ethyl]carbamothioylamino]benzoate |
|---|---|
| PubChem CID | 100729887 |
| Molecular Formula | C19H22N2O2S |
| Molecular Weight | 342.46 g/mol |
| Exact Mass | 342.14 |
| IUPAC Name | methyl 3-[[(1S)-1-(3,4-dimethylphenyl)ethyl]carbamothioylamino]benzoate |
| SMILES | COC(=O)c1cccc(NC(=S)N[C@@H](C)c2ccc(C)c(C)c2)c1 |
| InChI | InChI=1S/C19H22N2O2S/c1-12-8-9-15(10-13(12)2)14(3)20-19(24)21-17-7-5-6-16(11-17)18(22)23-4/h5-11,14H,1-4H3,(H2,20,21,24)/t14-/m0/s1 |
| InChIKey | NKMLPCOETPGHRU-AWEZNQCLSA-N |
| XLogP | 4.14 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.46 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|